jawapan module perfect score chemistry spm 2013

Download Jawapan Module Perfect Score Chemistry SPM 2013

Post on 06-May-2015

4.962 views

Category:

Education

1 download

Embed Size (px)

DESCRIPTION

Jawapan Module Perfect Score Chemistry SPM 2013, untuk rujukan guru dan pelajar.

TRANSCRIPT

  • 1.@Hak cipta BPSBPSK/SBP/2013BAHAGIAN PENGURUSAN SEKOLAH BERASRAMA PENUH DAN SEKOLAH KLUSTER http://cikguadura.wordpress.com/JAWAPAN MODUL PERFECT SCORE & X A-PLUS 2013CHEMISTRY 1Set Set Set Set SetPerfect Score & X A Plus Module/mark scheme 20131 2 3 4 5

2. @Hak cipta BPSBPSK/SBP/2013MODULE PERFECT SCORE & X A-PLUS 2013 http://cikguadura.wordpress.com/SET 1 :THE STRUCTURE OF ATOM, PERIODIC TABLE OF ELEMENTS AND CHEMICAL BONDS Question No 1(a)(i)Mark schemes Melting1(ii) Molecule (b)Mark1The heat energy absorbed by the particles is used to overcome the forces of attraction1between the naphthalene molecules / particles. (c)The particles move faster(d)(i)1X : electron1Y : nucleus(ii) Electron (i)(e)1 1W and X(ii) W and X atom have different number of neutrons but same number of protons1+1Atom// Element W and X has different nucleon number but same proton number 10Question No 2(a)Mark schemes No of electrons = 18, No of neutrons = 22(b)1+1(i)The total number of protons and neutrons in the nucleus of an atom(ii)40(i)(c)Mark2.111(ii) eXXX3p 4nXeX e(d)(i)W and Y1(ii)Atom W and Y have the same number of valence electrons1(iii) To estimate the age of fossils /artefacts.1 102Perfect Score & X A Plus Module/mark scheme 2013 3. @Hak cipta BPSBPSK/SBP/2013Question No. 3Mark SchemeMarks(i)Total number of protons and neutrons in the nucleus of an atom1(ii)35 18 = 171(iii)(a)shows nucleus and three shells occupied with electron1 +1Label 12 proton, 12 neutron(iv) (b)Number of electrons = 2(i)1 ...5 1Liquid(ii)1+1QR ...3(c)Temperature/oC90671+1Time/s 1st mark - Label X and Y axis with correct unit 2 nd mark - Correct shape of curve 103Perfect Score & X A Plus Module/mark scheme 2013 4. @Hak cipta BPSBPSK/SBP/2013a)b)(i)F1(ii)4Atom F has achieve stable/octet electron arrangement // has 8 valence electron12D + 2H2O 2DOH + H2 Correct reactant & correct product Balance equation The nuclei attraction towards the valence electrons is weaker in atom G. More easier for atom G to lose / release an electron to form a positively charged ion.1(i)(ii)c)(i)1 1+11Covalent bond(ii)1 1xE Yx xX Yx xE Yx(iii)1Show coloured ion//formed complex ion//has various oxidation number//act as catalyst(d)Cannot conduct electricity at any state/ low melting and boiling point/....1 115(a)1(i)Na/sodium, Mg/magnesium ....1(ii)Atomic size decreases across the period // Period 3.1(iii)(b)Increasing of proton number.1. Number of protons in atom increases when across the period. 2. Force of attraction between nucleus and electrons in the shell is stronger.1+1Chlorine more reactive than bromine Size of chlorine atom is smaller than bromine atom Chlorine atom is easier to receive one electron Al3+ Ionic compound1+1..4 (c)(d) (e)(i) (ii)1 11+1114Perfect Score & X A Plus Module/mark scheme 2013 5. @Hak cipta BPSBPSK/SBP/20136(a) (b)P : liquid (i)Q : solidR : gas1. P can be change to Q through freezing process. 2. When the liquid cooled, the particles in liquid lose energy and move slower. 3. As temperature drops, the liquid particles attract tone another and change into solid(ii)1. P can change to R through boiling. 2. When liquid is heated, the particles of the liquid gain kinetic energy and1 +1+1 1 1 1 1 1move faster as the temperature increase3. The particles have enough energy to overcome the forces between them and gas is formed (iii)(c)(i)(ii) (iii)(iv)51. R can be change to P through condensation process. 2. When the gas cooled, the particles in gas lose energy and move slower. 3. Particles attract one another and change into liquid 1. Uniform scale for X-axis and Y-axis and labelled/size of graph plotted of graph paper. 2. Tranfer of point 3. Smooth curve 1. Dotted line on the graph from the horizontal line to Y-axis at 80oC. 2. Arrow mark freezing point at 80oC 1. Heat released to sorrounding 2. Is balanced when particles comes together to form a solid SupercoolingPerfect Score & X A Plus Module/mark scheme 20131 1 1 1 1 1 1 1 1 1 1 1 20 6. @Hak cipta BPSBPSK/SBP/2013Question No. (a) (i) 7 (ii)(b)(i)Mark Scheme Atom R is located in Group 17, Period 3 Electron arrangement of atom R is 2.8.7. Group 17 because it has seven valence electron. Period 3 because it has three shells filled with electron Atoms P and R form covalent bond. To achieve the stable electron arrangement, atom P needs 4 electrons while atom R needs one electron. Thus, atom P shares 4 pairs of electrons with 4 atoms of R, forming a molecule with the formula PR4 // diagramMark 1 +1 1 1 1 1 1 1 1 1RRPRR(ii)Atom Q and atom R form ionic bond. Electron arrangement for atom Q is 2.8.1 and electron arrangement for atom R is 2.8.7// Atom Q has 1 valence electron while atow R has 7 valence electron To achieve a stable (octet ) electron arrangement, atom Q donates 1 electron to form a positive ion// equation Q Q+ + e1 1 1Atom R receives an electron to form ion R-//equation and achieve a stable octet electron arrangement. R+e R-1 1Ion Q+ and ion R- are attracted together by the strong electrostatic forces to form a compound with the formula QR// diagram1--+ Q6Perfect Score & X A Plus Module/mark scheme 2013R 7. @Hak cipta BPSBPSK/SBP/2013Question No 8 (a)(b)Mark schemeMark12 represents the nucleon number. 6 represents the proton number.1 1Able to draw the structure of an atom elements X. The diagram should be able to show the following informations: 1. correct number and position of proton in the nucleus/ at the centre of the atom. 2. correct number and position of neutron in the nucleus/ at the centre of the atom. 3. correct number and position of electron circulating the nucleus 4. correct number of valence electrons Sample answer:4 ee-ee--e11p1 12n 2e-e- 3 e-ee-e-oree-11p + 12n e-ee--ee-eee-7Perfect Score & X A Plus Module/mark scheme 2013e-1 11 1 8. @Hak cipta BPSBPSK/SBP/2013(c)(i)Atoms W and Y form covalent bond. To achieve the stable electron arrangement, atom W contributes 4 electrons while atom Y contributes one electron for sharing. Thus, atom W shares 4 pairs of electrons with 4 atoms of Y, forming a molecule with the formula WY4 // diagram1 1 1 1 1YYWYY(ii)Atom X and atom Y form ionic bond. Electron arrangement for atom X is 2.8.1 and electron arrangement for atom Y is 2.8.7 To achieve a stable (octet )electron arrangement, atom X donates 1 electron to form a positive ion // equation X X+ + e Atom Y receives an electron to form ion Y-//equation and achieve a stable octet electron arrangement. Y+e Y+ Ion X and ion Y are attracted together by the strong electrostatic forces to form a compound with the formula XY// diagram--+ X(d)1 1 11 11YThe melting point of the ionic compound/ (b)(ii) is higher than that of the covalent compound/ (b)(i) . This is because in ionic compounds oppositely ions are held by strong electrostatic forces. High energy is needed to overcome these forces. In covalent compounds, molecules are held by weak intermolecular forces. Only a little energy is required to overcome the attractive forces. OR The ionic compound/(b)(ii) conducts electricity in the molten or aqueous state whereas the covalent compound/(b)(i) does not conduct electricity. This is because in the molten or aqueous state, ionic compounds consist of freely moving ions carry electrical charges. Covalent compounds are made up of molecules only1 1 1 1 1 or 1 1 1 1 1 208Perfect Score & X A Plus Module/mark scheme 2013 9. @Hak cipta BPSBPSK/SBP/20139(a)(i)Q1. Correct number of shells and valence electrons 2. Black dot or label Q at the center of the atom (ii)(b)1. 2. 3. 4.(i)1. Floats and moves fast on the water 2. Hiss sound occurs 3. Gas liberates / bubble(ii)(c)(i) (ii)Group 14 There are 4 valence electrons Period 2 Atom consists of 2 shells occupied with electrons1 1 1 1 1 1 1 1[any two] 2Q + 2H2O 2QOH + H2 1. Correct reactant and product 2. Balanced equation Compound X Sharing electron between atom B and A Choose any one ionic compound and any one covalent compound.1 1 1 1Melting/boiling point Ionic compound 1. 2.High force of attraction between oppositely charged ions are strong. 3. more heat energy needs to overcome the forces. Electrical conductivity 4. 5.Ionic compound Conduct in molten state or aqueous solution. The free moving ions are able to carry electrical charges.Covalent compound low force of attraction between molecules are weak. less heat energy needs to overcome the forces.Covalent compound Not conduct electricity. Neutral molecules are not able to carry electrical charges.1 1 1 11 1 1 1Solubility6 7Ionic compound Soluble in water. Water molecule is polar solvent.Covalent compound soluble in benzene/ toluene / any organic solvents. The attraction forces between molecules in solute and solvent are the same. 209Perfect Score & X A Plus Module/mark scheme 2013 10. @Hak cipta BPSBPSK/SBP/201310(i) Compound formed between X and Y Ionic bond is formed because X atom donates electrons and Y atom receives electrons to achieve stable octet electron arrangement/involve transfer electron High because a lot of heat energy needed to overcome the strong electrostatic forces between ionsTypes of chemical bondsBoiling point and melting pointMolecule formed between Z and Y Covalent bond is formed because Z and Y atoms share the electrons to achieve stable electron arrangement //Inovelve sharing of electron Low because less heat energy is needed to overcome the weak forces of attraction between molecules221.Correct electron arrangement of 2 ions 2.Correct charges and nuclei are shown2+XXXXXXXXX X X(b)XX X X XX X XXXXXX X2-XXX2+XX X X X1 1XXXX XXY2-3. X atom with an electron arrangement of 2.8.2 donates 2 valence electrons to1achieve the stable octet electron arrangement, 2.8. X2+ ion is formed // X X2+ + 2e-14. Y atom with an electron arrangement of 2.6 accept 2 electrons to achieve the1stable octet electron arrangement, 2.8. Y2- ion is formed // Y + 2eY2-5. The oppositely-charged ions, X2+ and Y2- are attracted to each other by